N-[(6S)-6-Carboxy-6-(glycylamino)hexanoyl]-D-alanyl-D-alanine structure
|
Common Name | N-[(6S)-6-Carboxy-6-(glycylamino)hexanoyl]-D-alanyl-D-alanine | ||
|---|---|---|---|---|
| CAS Number | 306748-45-8 | Molecular Weight | 374.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H26N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-[(6S)-6-Carboxy-6-(glycylamino)hexanoyl]-D-alanyl-D-alanineN-[(6S)-6-Carboxy-6-(glycylamino)hexanoyl]-D-alanyl-D-alanine has the function of interfering with PAICS protein, which can effectively reduce SAICAR and SAICAr accumulation。 |
| Name | N-[(6S)-6-Carboxy-6-(glycylamino)hexanoyl]-D-alanyl-D-alanine |
|---|
| Description | N-[(6S)-6-Carboxy-6-(glycylamino)hexanoyl]-D-alanyl-D-alanine has the function of interfering with PAICS protein, which can effectively reduce SAICAR and SAICAr accumulation。 |
|---|---|
| Related Catalog | |
| References |
[1]. Guang PW, et, al. Compounds affecting saicar synthesis, and applications. WO2018059214. |
| Molecular Formula | C15H26N4O7 |
|---|---|
| Molecular Weight | 374.39 |
| InChIKey | OMRBEOKVIPPVRT-BBBLOLIVSA-N |
| SMILES | CC(NC(=O)C(C)N(C(=O)CN)C(=O)CCCCC(N)C(=O)O)C(=O)O |