Phosphorothioic acid O-ethyl O-methyl O-[p-(N,N-dimethylsulfamoyl)phenyl] ester structure
|
Common Name | Phosphorothioic acid O-ethyl O-methyl O-[p-(N,N-dimethylsulfamoyl)phenyl] ester | ||
|---|---|---|---|---|
| CAS Number | 3062-62-2 | Molecular Weight | 339.36800 | |
| Density | 1.321g/cm3 | Boiling Point | 407.6ºC at 760mmHg | |
| Molecular Formula | C11H18NO5PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.3ºC | |
| Name | 4-[ethoxy(methoxy)phosphinothioyl]oxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.321g/cm3 |
|---|---|
| Boiling Point | 407.6ºC at 760mmHg |
| Molecular Formula | C11H18NO5PS2 |
| Molecular Weight | 339.36800 |
| Flash Point | 200.3ºC |
| Exact Mass | 339.03600 |
| PSA | 115.35000 |
| LogP | 3.95450 |
| Index of Refraction | 1.548 |
| InChIKey | SYUFCKXQSWBHPR-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OC)Oc1ccc(S(=O)(=O)N(C)C)cc1 |
| HS Code | 2935009090 |
|---|
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Phosphorothioic acid,O-ethyl O-methyl ester,O-ester with N,N-dimethyl-p-hydroxybenzenesulfonamide |
| Benzenesulfonamide,N,N-dimethyl-p-hydroxy-,O-ester with O-ethyl O-methyl phosphorothioate |