benzene-1,3-dicarboxylic acid,butane-1,4-diol,terephthalic acid
Modify Date: 2025-11-24 21:47:33
benzene-1,3-dicarboxylic acid,butane-1,4-diol,terephthalic acid structure
|
Common Name | benzene-1,3-dicarboxylic acid,butane-1,4-diol,terephthalic acid | ||
|---|---|---|---|---|
| CAS Number | 30580-17-7 | Molecular Weight | 422.38300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H22O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzene-1,3-dicarboxylic acid,butane-1,4-diol,terephthalic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H22O10 |
|---|---|
| Molecular Weight | 422.38300 |
| Exact Mass | 422.12100 |
| PSA | 189.66000 |
| LogP | 1.91720 |
| InChIKey | JOPKUZQHGDBDJS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C(=O)O)cc1.O=C(O)c1cccc(C(=O)O)c1.OCCCCO |
| 1,3-Benzenedicarboxylic acid,polymer with 1,4-benzenedicarboxylic acid and 1,4-butanediol |
| Terephthalic acid,isophthalic acid,1,4-butanediol polymer |