2,4,8,10-tetraoxaspiro[5.5]undecane-3,9-dipropionic acid structure
|
Common Name | 2,4,8,10-tetraoxaspiro[5.5]undecane-3,9-dipropionic acid | ||
|---|---|---|---|---|
| CAS Number | 3058-05-7 | Molecular Weight | 304.29300 | |
| Density | 1.37g/cm3 | Boiling Point | 492.8ºC at 760mmHg | |
| Molecular Formula | C13H20O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.5ºC | |
| Name | 3-[3-(2-carboxyethyl)-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 492.8ºC at 760mmHg |
| Molecular Formula | C13H20O8 |
| Molecular Weight | 304.29300 |
| Flash Point | 184.5ºC |
| Exact Mass | 304.11600 |
| PSA | 111.52000 |
| LogP | 0.44820 |
| Index of Refraction | 1.53 |
| InChIKey | PVCPWBCCWVKROB-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC1OCC2(CO1)COC(CCC(=O)O)OC2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 221-295-4 |