4-[p-Chlorobenzoyl(2,4-dimethoxyphenyl)amino]butyric acid
Modify Date: 2025-09-14 11:13:41
![4-[p-Chlorobenzoyl(2,4-dimethoxyphenyl)amino]butyric acid Structure](https://image.chemsrc.com/caspic/002/30544-68-4.png)
4-[p-Chlorobenzoyl(2,4-dimethoxyphenyl)amino]butyric acid structure
|
Common Name | 4-[p-Chlorobenzoyl(2,4-dimethoxyphenyl)amino]butyric acid | ||
|---|---|---|---|---|
| CAS Number | 30544-68-4 | Molecular Weight | 377.81900 | |
| Density | 1.298g/cm3 | Boiling Point | 589.9ºC at 760mmHg | |
| Molecular Formula | C19H20ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.5ºC | |
| Name | 4-(N-(4-chlorobenzoyl)-2,4-dimethoxyanilino)butanoic acid |
|---|
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 589.9ºC at 760mmHg |
| Molecular Formula | C19H20ClNO5 |
| Molecular Weight | 377.81900 |
| Flash Point | 310.5ºC |
| Exact Mass | 377.10300 |
| PSA | 76.07000 |
| LogP | 3.86880 |
| Index of Refraction | 1.597 |
| InChIKey | UFDZVKDBCVJSBS-UHFFFAOYSA-N |
| SMILES | COc1ccc(N(CCCC(=O)O)C(=O)c2ccc(Cl)cc2)c(OC)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |