Bis-(m-chlorophenylpiperazino)-methane
Modify Date: 2025-08-25 18:39:22
Bis-(m-chlorophenylpiperazino)-methane structure
|
Common Name | Bis-(m-chlorophenylpiperazino)-methane | ||
|---|---|---|---|---|
| CAS Number | 30534-29-3 | Molecular Weight | 405.36400 | |
| Density | 1.254g/cm3 | Boiling Point | 552.1ºC at 760mmHg | |
| Molecular Formula | C21H26Cl2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.7ºC | |
| Name | 1,1'-Methylenebis[4-(3-chlorophenyl)piperazine] |
|---|---|
| Synonym | More Synonyms |
| Density | 1.254g/cm3 |
|---|---|
| Boiling Point | 552.1ºC at 760mmHg |
| Molecular Formula | C21H26Cl2N4 |
| Molecular Weight | 405.36400 |
| Flash Point | 287.7ºC |
| Exact Mass | 404.15300 |
| PSA | 12.96000 |
| LogP | 3.90090 |
| Index of Refraction | 1.613 |
| InChIKey | MZAJTJOMSOORSE-UHFFFAOYSA-N |
| SMILES | Clc1cccc(N2CCN(CN3CCN(c4cccc(Cl)c4)CC3)CC2)c1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,1'-Methandiyl-bis-pyridinium,Jodid |
| 1-(pyridin-1-ium-1-ylmethyl)pyridin-1-ium diiodide |
| dipyridiniomethandiiodide |
| 1,1'-Methandiyl-bis-pyridinium,Dijodid |
| 1,1'-Methylen-bis-<4-(3-chlorophenyl)-piperazin> |
| 4,4'-bis-(3-chloro-phenyl)-1,1'-methanediyl-bis-piperazine |
| 4428P |
| 1,1'-methanediyl-bis-pyridinium,diiodide |
| 1-(pyridinium-1-ylmethyl)pyridinium diiodide |