Flurantel
Modify Date: 2025-10-14 06:31:41
Flurantel structure
|
Common Name | Flurantel | ||
|---|---|---|---|---|
| CAS Number | 30533-89-2 | Molecular Weight | 494.29800 | |
| Density | 1.533g/cm3 | Boiling Point | 459.7ºC at 760 mmHg | |
| Molecular Formula | C19H12F6N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.8ºC | |
| Name | [3-acetyloxy-2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-4-nitrophenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.533g/cm3 |
|---|---|
| Boiling Point | 459.7ºC at 760 mmHg |
| Molecular Formula | C19H12F6N2O7 |
| Molecular Weight | 494.29800 |
| Flash Point | 231.8ºC |
| Exact Mass | 494.05500 |
| PSA | 131.01000 |
| LogP | 5.64250 |
| Index of Refraction | 1.532 |
| InChIKey | YRPPAQRAYJVJOS-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc([N+](=O)[O-])c(OC(C)=O)c1C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,6-bis(acetyloxy)-n-[3,5-bis(trifluoromethyl)phenyl]-3-nitrobenzamide |
| 3-Nitro-2,6-diacetoxybenzoesaeure-3',5'-bis-trifluormethylanilid |
| UNII-3Q14SL1C0O |
| Flurantel [INN] |
| Flurantel |