(benzylsulfinyl-dichloro-methyl)benzene
Modify Date: 2025-08-25 23:34:52
(benzylsulfinyl-dichloro-methyl)benzene structure
|
Common Name | (benzylsulfinyl-dichloro-methyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 30505-98-7 | Molecular Weight | 299.21500 | |
| Density | 1.384g/cm3 | Boiling Point | 461ºC at 760 mmHg | |
| Molecular Formula | C14H12Cl2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.6ºC | |
| Name | Benzyl-α,α-dichlorbenzylsulfoxid |
|---|
| Density | 1.384g/cm3 |
|---|---|
| Boiling Point | 461ºC at 760 mmHg |
| Molecular Formula | C14H12Cl2OS |
| Molecular Weight | 299.21500 |
| Flash Point | 232.6ºC |
| Exact Mass | 297.99900 |
| PSA | 36.28000 |
| LogP | 5.08910 |
| Index of Refraction | 1.645 |
| InChIKey | DOAMNYJUZXKOFC-UHFFFAOYSA-N |
| SMILES | O=S(Cc1ccccc1)C(Cl)(Cl)c1ccccc1 |
|
~%
(benzylsulfinyl... CAS#:30505-98-7 |
| Literature: Carpino,L.A. et al. Journal of the American Chemical Society, 1971 , vol. 93, p. 476 - 484 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
![Benzene,[dichloro[(phenylmethyl)sulfonyl]methyl]- structure](https://image.chemsrc.com/caspic/103/10038-08-1.png)
CAS#:10038-08-1