methyl 1-phenylbicyclo[1.1.0]butane-3-carboxylate
Modify Date: 2025-08-25 14:25:09
![methyl 1-phenylbicyclo[1.1.0]butane-3-carboxylate Structure](https://image.chemsrc.com/caspic/072/30493-96-0.png)
methyl 1-phenylbicyclo[1.1.0]butane-3-carboxylate structure
|
Common Name | methyl 1-phenylbicyclo[1.1.0]butane-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 30493-96-0 | Molecular Weight | 188.22200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 1-phenylbicyclo[1.1.0]butane-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12O2 |
|---|---|
| Molecular Weight | 188.22200 |
| Exact Mass | 188.08400 |
| PSA | 26.30000 |
| LogP | 1.89120 |
| InChIKey | ZKBDVTAODHCHTL-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC1(c1ccccc1)C2 |
|
~%
methyl 1-phenyl... CAS#:30493-96-0 |
| Literature: Hall,H.K. et al. Journal of the American Chemical Society, 1971 , vol. 93, p. 121 - 130 |
|
~%
methyl 1-phenyl... CAS#:30493-96-0 |
| Literature: Hall,H.K. et al. Journal of the American Chemical Society, 1971 , vol. 93, p. 121 - 130 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| methyl 3-phenylbicyclobutane-1-carboxylate |
| methyl 3-phenylbicyclo<1.1.0>butanecarboxylate |
| 3-Phenyl-1-bicyclobutancarbonsaeure-methylester |