2-amino-5-nitro-N-phenylbenzamide
Modify Date: 2025-08-30 10:30:09
2-amino-5-nitro-N-phenylbenzamide structure
|
Common Name | 2-amino-5-nitro-N-phenylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 30481-54-0 | Molecular Weight | 257.24500 | |
| Density | 1.41g/cm3 | Boiling Point | 410.2ºC at 760 mmHg | |
| Molecular Formula | C13H11N3O3 | Melting Point | 202-204ºC | |
| MSDS | N/A | Flash Point | 201.9ºC | |
| Name | 2-amino-5-nitro-N-phenylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 410.2ºC at 760 mmHg |
| Melting Point | 202-204ºC |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.24500 |
| Flash Point | 201.9ºC |
| Exact Mass | 257.08000 |
| PSA | 100.94000 |
| LogP | 3.60670 |
| Index of Refraction | 1.714 |
| InChIKey | INKGKPCLQCFQKB-UHFFFAOYSA-N |
| SMILES | Nc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
2-amino-5-nitro... CAS#:30481-54-0 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 53, p. 222 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-amino-5-nitro-benzoic acid anilide |
| 2-Amino-5-nitro-benzoesaeure-anilid |
| 2-azanyl-5-nitro-N-phenyl-benzamide |
| 5-Nitroanthranilsaeureanilid |
| 2-Amino-5-nitrobenzanilide |
| 3-Nitro-6-amino-N-phenylbenzamid |