2,4-Cyclohexadiene-1,1,3-tricarbonitrile,2-amino-4,6,6-trimethyl- structure
|
Common Name | 2,4-Cyclohexadiene-1,1,3-tricarbonitrile,2-amino-4,6,6-trimethyl- | ||
|---|---|---|---|---|
| CAS Number | 30481-45-9 | Molecular Weight | 212.25000 | |
| Density | 1.17g/cm3 | Boiling Point | 510.7ºC at 760 mmHg | |
| Molecular Formula | C12H12N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.7ºC | |
| Name | 2-amino-4,6,6-trimethylcyclohexa-2,4-diene-1,1,3-tricarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 510.7ºC at 760 mmHg |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.25000 |
| Flash Point | 262.7ºC |
| Exact Mass | 212.10600 |
| PSA | 97.39000 |
| LogP | 2.44274 |
| Index of Refraction | 1.558 |
| InChIKey | OTYOEOKUIGHOGA-UHFFFAOYSA-N |
| SMILES | CC1=CC(C)(C)C(C#N)(C#N)C(N)=C1C#N |
| HS Code | 2926909090 |
|---|
|
~48%
2,4-Cyclohexadi... CAS#:30481-45-9 |
| Literature: Dyachenko; Rusanov Russian Journal of Organic Chemistry, 2006 , vol. 42, # 9 p. 1374 - 1379 |
|
~%
2,4-Cyclohexadi... CAS#:30481-45-9 |
| Literature: Apsimon,J.W. et al. Canadian Journal of Chemistry, 1970 , vol. 48, p. 3064 - 3075 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-amino-4,6,6-trimethyl-cyclohexa-2,4-diene-1,1,3-tricarbonitrile |
| 2-Amino-4,6,6-trimethyl-cyclohexa-2,4-dien-1,1,3-tricarbonitril |
| 2-Amino-4,6,6-trimethyl-2,4-cyclohexadiene-1,1,3-tricarbonitrile |
| 1-Amino-2,6,6-tricyan-3,5,5-trimethyl-cyclohexa-1,3-dien |
| isopropylidenemalononitrile dimer |