N',N'-diethyl-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]ethane-1,2-diamine structure
|
Common Name | N',N'-diethyl-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]ethane-1,2-diamine | ||
|---|---|---|---|---|
| CAS Number | 304694-40-4 | Molecular Weight | 350.421 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 408.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H25F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.6±28.7 °C | |
| Name | N',N'-diethyl-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]ethane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 408.1±45.0 °C at 760 mmHg |
| Molecular Formula | C20H25F3N2 |
| Molecular Weight | 350.421 |
| Flash Point | 200.6±28.7 °C |
| Exact Mass | 350.196991 |
| PSA | 15.27000 |
| LogP | 5.74 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | CQBYREFQWDUSJY-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNCc1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
|
~88%
N',N'-diethyl-N... CAS#:304694-40-4 |
| Literature: Nagano, Joseph M.G.; Hsu, Ku-Lung; Whitby, Landon R.; Niphakis, Micah J.; Speers, Anna E.; Brown, Steven J.; Spicer, Timothy; Fernandez-Vega, Virneliz; Ferguson, Jill; Hodder, Peter; Srinivasan, Prabhavathi; Gonzalez, Tara D.; Rosen, Hugh; Bahnson, Brian J.; Cravatt, Benjamin F. Bioorganic and Medicinal Chemistry Letters, 2013 , vol. 23, # 3 p. 839 - 843 |
|
~%
N',N'-diethyl-N... CAS#:304694-40-4 |
| Literature: BAYER HEALTHCARE AG Patent: WO2006/63812 A1, 2006 ; Location in patent: Page/Page column 24-25 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N-Diethyl-N'-{[4'-(trifluoromethyl)-4-biphenylyl]methyl}-1,2-ethanediamine |
| qc-2 |
| 1,2-Ethanediamine, N,N-diethyl-N-[[4'-(trifluoromethyl)[1,1'-biphenyl]-4-yl]methyl]- |