2-Butanone, 4-phenyl-,2-(2,4-dinitrophenyl)hydrazone
Modify Date: 2025-09-14 17:52:40
2-Butanone, 4-phenyl-,2-(2,4-dinitrophenyl)hydrazone structure
|
Common Name | 2-Butanone, 4-phenyl-,2-(2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 30435-51-9 | Molecular Weight | 328.32300 | |
| Density | 1.3g/cm3 | Boiling Point | 489.8ºC at 760 mmHg | |
| Molecular Formula | C16H16N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250ºC | |
| Name | 2,4-dinitro-N-[(Z)-4-phenylbutan-2-ylideneamino]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 489.8ºC at 760 mmHg |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.32300 |
| Flash Point | 250ºC |
| Exact Mass | 328.11700 |
| PSA | 116.03000 |
| LogP | 5.04300 |
| Index of Refraction | 1.617 |
| InChIKey | WHTNICIAOKIYQM-ATVHPVEESA-N |
| SMILES | CC(CCc1ccccc1)=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2928000090 |
|---|
|
~%
2-Butanone, 4-p... CAS#:30435-51-9 |
| Literature: Briggs; De Ath; Ellis Journal of the Chemical Society, 1942 , p. 61 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1-Phenyl-butanon-(3)-2.4-dinitro-phenylhydrazon |
| Methyl-<2-phenyl-aethyl>-keton-<2.4-dinitro-phenylhydrazon> |
| 4-Phenyl-2-butanon-2,4-dinitrophenylhydrazon |
| 4-Phenyl-butan-2-on-(2,4-dinitro-phenylhydrazon) |
| 4-phenyl-butan-2-one-(2,4-dinitro-phenylhydrazone) |
| Benzylaceton-<2.4-dinitro-phenylhydrazon> |
| 2-<2.4-Dinitro-phenylhydrazono>-4-phenyl-butan |