ω-(Dimethylamino)-3',4'-(methylenedioxy)propiophenone
Modify Date: 2025-08-21 10:40:25
ω-(Dimethylamino)-3',4'-(methylenedioxy)propiophenone structure
|
Common Name | ω-(Dimethylamino)-3',4'-(methylenedioxy)propiophenone | ||
|---|---|---|---|---|
| CAS Number | 30418-50-9 | Molecular Weight | 221.25200 | |
| Density | 1.171g/cm3 | Boiling Point | 356.9ºC at 760 mmHg | |
| Molecular Formula | C12H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.7ºC | |
| Name | 1-(1,3-benzodioxol-5-yl)-3-(dimethylamino)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.171g/cm3 |
|---|---|
| Boiling Point | 356.9ºC at 760 mmHg |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.25200 |
| Flash Point | 169.7ºC |
| Exact Mass | 221.10500 |
| PSA | 38.77000 |
| LogP | 1.54970 |
| Index of Refraction | 1.548 |
| InChIKey | PWBLOELLKGNDKI-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(=O)c1ccc2c(c1)OCO2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Safrole I |
| 5-<3-Dimethylamino-propionyl>-benzo<1,3>dioxol |