2-N,4-N-dimethyl-2-N,4-N-diphenyl-1,3,5-triazine-2,4,6-triamine
Modify Date: 2025-09-18 18:20:11
2-N,4-N-dimethyl-2-N,4-N-diphenyl-1,3,5-triazine-2,4,6-triamine structure
|
Common Name | 2-N,4-N-dimethyl-2-N,4-N-diphenyl-1,3,5-triazine-2,4,6-triamine | ||
|---|---|---|---|---|
| CAS Number | 30377-20-9 | Molecular Weight | 306.36500 | |
| Density | 1.273g/cm3 | Boiling Point | 523.7ºC at 760 mmHg | |
| Molecular Formula | C17H18N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.5ºC | |
| Name | 2-N,4-N-dimethyl-2-N,4-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.273g/cm3 |
|---|---|
| Boiling Point | 523.7ºC at 760 mmHg |
| Molecular Formula | C17H18N6 |
| Molecular Weight | 306.36500 |
| Flash Point | 270.5ºC |
| Exact Mass | 306.15900 |
| PSA | 71.90000 |
| LogP | 2.91970 |
| Index of Refraction | 1.699 |
| InChIKey | ZMPMKWXNFFUVCK-UHFFFAOYSA-N |
| SMILES | CN(c1ccccc1)c1nc(N)nc(N(C)c2ccccc2)n1 |
| HS Code | 2933699090 |
|---|
|
~%
2-N,4-N-dimethy... CAS#:30377-20-9 |
| Literature: Kaiser et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 2984 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 1,3,5-Triazine-2,4,6-triamine,N2,N4-dimethyl-N2,N4-diphenyl |
| N2,N4-dimethyl-N2,N4-diphenyl-1,3,5-triazine-2,4,6-triamine |