2-N,2-N-diphenyl-6-(tribromomethyl)-1,3,5-triazine-2,4-diamine
Modify Date: 2025-08-21 18:13:12
2-N,2-N-diphenyl-6-(tribromomethyl)-1,3,5-triazine-2,4-diamine structure
|
Common Name | 2-N,2-N-diphenyl-6-(tribromomethyl)-1,3,5-triazine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 30359-73-0 | Molecular Weight | 514.01200 | |
| Density | 1.993g/cm3 | Boiling Point | 550ºC at 760mmHg | |
| Molecular Formula | C16H12Br3N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.4ºC | |
| Name | 2-N,2-N-diphenyl-6-(tribromomethyl)-1,3,5-triazine-2,4-diamine |
|---|
| Density | 1.993g/cm3 |
|---|---|
| Boiling Point | 550ºC at 760mmHg |
| Molecular Formula | C16H12Br3N5 |
| Molecular Weight | 514.01200 |
| Flash Point | 286.4ºC |
| Exact Mass | 510.86400 |
| PSA | 68.66000 |
| LogP | 5.14870 |
| Index of Refraction | 1.768 |
| InChIKey | ZASNDAMYCBYQGD-UHFFFAOYSA-N |
| SMILES | Nc1nc(N(c2ccccc2)c2ccccc2)nc(C(Br)(Br)Br)n1 |
| HS Code | 2933699090 |
|---|
|
~%
2-N,2-N-dipheny... CAS#:30359-73-0 |
| Literature: Broche Journal fuer Praktische Chemie (Leipzig), 1894 , vol. <2> 50, p. 116 |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |