N-(3,4-dichlorophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazin-2-amine structure
|
Common Name | N-(3,4-dichlorophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 30356-55-9 | Molecular Weight | 475.80000 | |
| Density | 1.818g/cm3 | Boiling Point | 491.3ºC at 760 mmHg | |
| Molecular Formula | C11H4Cl8N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.9ºC | |
| Name | N-(3,4-dichlorophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazin-2-amine |
|---|
| Density | 1.818g/cm3 |
|---|---|
| Boiling Point | 491.3ºC at 760 mmHg |
| Molecular Formula | C11H4Cl8N4 |
| Molecular Weight | 475.80000 |
| Flash Point | 250.9ºC |
| Exact Mass | 471.79400 |
| PSA | 53.93000 |
| LogP | 5.99730 |
| Index of Refraction | 1.67 |
| InChIKey | JFAAAMRJUVFHKM-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Nc2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1Cl |
|
~74%
N-(3,4-dichloro... CAS#:30356-55-9 |
| Literature: Werbel, Leslie M.; Elslager, Edward F.; Hess, Carolyn; Hutt, Marland P. Journal of Medicinal Chemistry, 1987 , vol. 30, # 11 p. 1943 - 1948 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |