2-Ethyl-2-adamantyl acrylate
Modify Date: 2025-11-27 14:38:34
2-Ethyl-2-adamantyl acrylate structure
|
Common Name | 2-Ethyl-2-adamantyl acrylate | ||
|---|---|---|---|---|
| CAS Number | 303186-14-3 | Molecular Weight | 234.33400 | |
| Density | 1.06g/cm3 | Boiling Point | 301.864ºC at 760 mmHg | |
| Molecular Formula | C15H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.039ºC | |
| Name | (2-ethyl-2-adamantyl) prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 301.864ºC at 760 mmHg |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.33400 |
| Flash Point | 123.039ºC |
| Exact Mass | 234.16200 |
| PSA | 26.30000 |
| LogP | 3.32050 |
| Index of Refraction | 1.517 |
| InChIKey | NLNVUFXLNHSIQH-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OC1(CC)C2CC3CC(C2)CC1C3 |
| HS Code | 2916129000 |
|---|
| HS Code | 2916129000 |
|---|---|
| Summary | 2916129000 other esters of acrylic acid VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| acrylic acid 2-ethyladamantane-2-yl |
| acrylic acid-2-ethyl-2-adamantyl |
| 2-acryloyloxy-2-ethyladamantane |
| 2-Ethyladamantan-2-yl acrylate |
| 2-ethyl-2-adamantyl acrylate |