2-iodo-N'-[(4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzohydrazide
Modify Date: 2025-09-13 17:10:39
![2-iodo-N'-[(4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzohydrazide Structure](https://image.chemsrc.com/caspic/458/303065-85-2.png)
2-iodo-N'-[(4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzohydrazide structure
|
Common Name | 2-iodo-N'-[(4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzohydrazide | ||
|---|---|---|---|---|
| CAS Number | 303065-85-2 | Molecular Weight | 366.15400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11IN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-iodo-N'-[(4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzohydrazide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11IN2O2 |
|---|---|
| Molecular Weight | 366.15400 |
| Exact Mass | 365.98700 |
| PSA | 65.18000 |
| LogP | 3.33550 |
| InChIKey | OQYIZXRSEPZKIX-UHFFFAOYSA-N |
| SMILES | O=C(NN=Cc1ccc(O)cc1)c1ccccc1I |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| t4236 |