4-[(9-Anthracenylmethylene)amino]-1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one structure
|
Common Name | 4-[(9-Anthracenylmethylene)amino]-1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 303019-69-4 | Molecular Weight | 391.46 | |
| Density | 1.18±0.1 g/cm3(Predicted) | Boiling Point | 580.2±60.0 °C(Predicted) | |
| Molecular Formula | C26H21N3O | Melting Point | 231-232 °C(Solv: methanol (67-56-1); chloroform (67-66-3)) | |
| MSDS | USA | Flash Point | N/A | |
| Name | 4-[(9-Anthracenylmethylene)amino]-1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one |
|---|
| Density | 1.18±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 580.2±60.0 °C(Predicted) |
| Melting Point | 231-232 °C(Solv: methanol (67-56-1); chloroform (67-66-3)) |
| Molecular Formula | C26H21N3O |
| Molecular Weight | 391.46 |
| InChIKey | RNXZNZGMBZVMDC-UHFFFAOYSA-N |
| SMILES | Cc1c(N=Cc2c3ccccc3cc3ccccc23)c(=O)n(-c2ccccc2)n1C |
| RIDADR | NONH for all modes of transport |
|---|
|
Fe(3+)-selective fluorescent probe based on aminoantipyrine in aqueous solution.
Spectrochim. Acta. A. Mol. Biomol. Spectrosc. 98 , 14-17, (2012) A novel and simple Schiff base composed with 9-anthraldehyde and 4-aminoantipyrine was synthesized and characterized as a fluorescent probe. In the presence of Fe(3+), the fluorescent intensity has a ... |