Ethanedioic acid,1,2-bis(2-phenylhydrazide) structure
|
Common Name | Ethanedioic acid,1,2-bis(2-phenylhydrazide) | ||
|---|---|---|---|---|
| CAS Number | 3030-75-9 | Molecular Weight | 270.28700 | |
| Density | 1.343g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-N',2-N'-diphenylethanedihydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.343g/cm3 |
|---|---|
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.28700 |
| Exact Mass | 270.11200 |
| PSA | 82.26000 |
| LogP | 2.20080 |
| Index of Refraction | 1.69 |
| InChIKey | KNYRBAZKFQHSLZ-UHFFFAOYSA-N |
| SMILES | O=C(NNc1ccccc1)C(=O)NNc1ccccc1 |
| HS Code | 2928000090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N1',N2'-diphenylethanedihydrazide |
| Oxalsaeure-bis-phenylhydrazid |
| 2',2'-diphenyl-ethanedioic acid dihydrazide |
| HMS3080A23 |