Morpholine,4,4'-(p-dioxane-2,5-diyldimethylene)di- (6CI,7CI,8CI)
Modify Date: 2025-09-03 21:12:46
Morpholine,4,4'-(p-dioxane-2,5-diyldimethylene)di- (6CI,7CI,8CI) structure
|
Common Name | Morpholine,4,4'-(p-dioxane-2,5-diyldimethylene)di- (6CI,7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 3030-46-4 | Molecular Weight | 286.36700 | |
| Density | 1.132g/cm3 | Boiling Point | 403.1ºC at 760 mmHg | |
| Molecular Formula | C14H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119.3ºC | |
| Name | 4-[[5-(morpholin-4-ylmethyl)-1,4-dioxan-2-yl]methyl]morpholine |
|---|
| Density | 1.132g/cm3 |
|---|---|
| Boiling Point | 403.1ºC at 760 mmHg |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.36700 |
| Flash Point | 119.3ºC |
| Exact Mass | 286.18900 |
| PSA | 43.40000 |
| Index of Refraction | 1.499 |
| InChIKey | WLCAKOIADARDFN-UHFFFAOYSA-N |
| SMILES | C1CN(CC2COC(CN3CCOCC3)CO2)CCO1 |
| HS Code | 2934999090 |
|---|
|
~%
Morpholine,4,4'... CAS#:3030-46-4 |
| Literature: Heywood; Phillips Journal of the American Chemical Society, 1958 , vol. 80, p. 1257 |
|
~%
Morpholine,4,4'... CAS#:3030-46-4 |
| Literature: Heywood; Phillips Journal of the American Chemical Society, 1958 , vol. 80, p. 1257 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |