2-(4-chlorophenoxy)-N-(cyclohexylideneamino)acetamide
Modify Date: 2025-10-03 09:18:47
2-(4-chlorophenoxy)-N-(cyclohexylideneamino)acetamide structure
|
Common Name | 2-(4-chlorophenoxy)-N-(cyclohexylideneamino)acetamide | ||
|---|---|---|---|---|
| CAS Number | 302908-78-7 | Molecular Weight | 280.75000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-chlorophenoxy)-N-(cyclohexylideneamino)acetamide |
|---|
| Molecular Formula | C14H17ClN2O2 |
|---|---|
| Molecular Weight | 280.75000 |
| Exact Mass | 280.09800 |
| PSA | 54.18000 |
| LogP | 3.99540 |
| InChIKey | JDJGYKZYSUMXTB-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccc(Cl)cc1)NN=C1CCCCC1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |