3,5-Dimethylthiazolo[3,2-a]pyridinium-8-olate structure
|
Common Name | 3,5-Dimethylthiazolo[3,2-a]pyridinium-8-olate | ||
|---|---|---|---|---|
| CAS Number | 30277-00-0 | Molecular Weight | 179.23900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-dimethyl-[1,3]thiazolo[3,2-a]pyridin-4-ium-8-olate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9NOS |
|---|---|
| Molecular Weight | 179.23900 |
| Exact Mass | 179.04000 |
| PSA | 49.72000 |
| LogP | 1.97780 |
| InChIKey | VSJUEYWEHFPCSS-UHFFFAOYSA-N |
| SMILES | Cc1ccc([O-])c2scc(C)[n+]12 |
| HS Code | 2934100090 |
|---|
|
~%
3,5-Dimethylthi... CAS#:30277-00-0 |
| Literature: Undheim,K.; Reistad,K.R. Acta Chemica Scandinavica (1947-1973), 1970 , vol. 24, p. 2956 - 2968 |
|
~%
3,5-Dimethylthi... CAS#:30277-00-0 |
| Literature: Ulsaker,G.A. et al. Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1978 , vol. 32, p. 460 - 462 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3,5-Dimethylthiazolo<3,2-a>pyridinium-8-olat |
| 3,5-Dimethylthiazol<3,2-a>pyridinium-8-oxid |