N-(6-nitropyren-1-yl)acetamide structure
|
Common Name | N-(6-nitropyren-1-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 30268-98-5 | Molecular Weight | 304.29900 | |
| Density | 1.47g/cm3 | Boiling Point | 601.7ºC at 760mmHg | |
| Molecular Formula | C18H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317.7ºC | |
| Name | N-(6-nitropyren-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 601.7ºC at 760mmHg |
| Molecular Formula | C18H12N2O3 |
| Molecular Weight | 304.29900 |
| Flash Point | 317.7ºC |
| Exact Mass | 304.08500 |
| PSA | 78.41000 |
| LogP | 5.62330 |
| Index of Refraction | 1.86 |
| InChIKey | JYINWLDELFGNBG-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc2ccc3c([N+](=O)[O-])ccc4ccc1c2c43 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Acetylamino-6-nitro-pyren |