4-methyl-5-phenyl-2,2-bis(trifluoromethyl)-1,3-oxazolidine
Modify Date: 2025-09-14 09:24:51
4-methyl-5-phenyl-2,2-bis(trifluoromethyl)-1,3-oxazolidine structure
|
Common Name | 4-methyl-5-phenyl-2,2-bis(trifluoromethyl)-1,3-oxazolidine | ||
|---|---|---|---|---|
| CAS Number | 30184-88-4 | Molecular Weight | 299.21200 | |
| Density | 1.332g/cm3 | Boiling Point | 266.2ºC at 760mmHg | |
| Molecular Formula | C12H11F6NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.8ºC | |
| Name | 4-methyl-5-phenyl-2,2-bis(trifluoromethyl)-1,3-oxazolidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.332g/cm3 |
|---|---|
| Boiling Point | 266.2ºC at 760mmHg |
| Molecular Formula | C12H11F6NO |
| Molecular Weight | 299.21200 |
| Flash Point | 114.8ºC |
| Exact Mass | 299.07400 |
| PSA | 21.26000 |
| LogP | 3.88570 |
| Index of Refraction | 1.425 |
| InChIKey | ZNPHPNNGNBZVNM-UHFFFAOYSA-N |
| SMILES | CC1NC(C(F)(F)F)(C(F)(F)F)OC1c1ccccc1 |
|
~%
4-methyl-5-phen... CAS#:30184-88-4 |
| Literature: Crank,G. et al. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 1215 - 1217 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-methyl-5-phenyl-2,2-bis-trifluoromethyl-oxazolidine |