7-(2-chlorophenyl)-5-hydroxy-1,3-benzoxathiol-2-one structure
|
Common Name | 7-(2-chlorophenyl)-5-hydroxy-1,3-benzoxathiol-2-one | ||
|---|---|---|---|---|
| CAS Number | 301681-73-2 | Molecular Weight | 278.71100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-(2-chlorophenyl)-5-hydroxy-1,3-benzoxathiol-2-one |
|---|
| Molecular Formula | C13H7ClO3S |
|---|---|
| Molecular Weight | 278.71100 |
| Exact Mass | 277.98000 |
| PSA | 78.68000 |
| LogP | 3.88050 |
| InChIKey | IKQKTNUVTJUWGY-UHFFFAOYSA-N |
| SMILES | O=c1oc2c(-c3ccccc3Cl)cc(O)cc2s1 |
|
~67%
7-(2-chlorophen... CAS#:301681-73-2 |
| Literature: Obushak; Matiichuk; Martyak Chemistry of Heterocyclic Compounds, 2001 , vol. 37, # 7 p. 909 - 915 |
|
~%
7-(2-chlorophen... CAS#:301681-73-2 |
| Literature: Obushak; Matiichuk; Martyak Chemistry of Heterocyclic Compounds, 2001 , vol. 37, # 7 p. 909 - 915 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |