2,4-Pteridinediamine,6-(4-chlorophenyl)- structure
|
Common Name | 2,4-Pteridinediamine,6-(4-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 30146-32-8 | Molecular Weight | 272.69300 | |
| Density | 1.529g/cm3 | Boiling Point | 578.9ºC at 760mmHg | |
| Molecular Formula | C12H9ClN6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.9ºC | |
| Name | 6-(4-chlorophenyl)pteridine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.529g/cm3 |
|---|---|
| Boiling Point | 578.9ºC at 760mmHg |
| Molecular Formula | C12H9ClN6 |
| Molecular Weight | 272.69300 |
| Flash Point | 303.9ºC |
| Exact Mass | 272.05800 |
| PSA | 103.60000 |
| LogP | 3.06700 |
| Index of Refraction | 1.774 |
| InChIKey | QQCCDUKVAFUHCW-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c2nc(-c3ccc(Cl)cc3)cnc2n1 |
| HS Code | 2933990090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-Diamino-6-(p-chlor-phenyl)-pteridin |
| 2,4-Diamino-6-[p-chlorophenyl]pteridine |
| 6-(4-chloro-phenyl)-pteridine-2,4-diamine |