propan-2-yl 3-(4-propan-2-yloxyphenyl)propanoate structure
|
Common Name | propan-2-yl 3-(4-propan-2-yloxyphenyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 301224-94-2 | Molecular Weight | 250.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | propan-2-yl 3-(4-propan-2-yloxyphenyl)propanoate |
|---|
| Molecular Formula | C15H22O3 |
|---|---|
| Molecular Weight | 250.33300 |
| Exact Mass | 250.15700 |
| PSA | 35.53000 |
| LogP | 3.35800 |
| InChIKey | GZIQFBOOHGNGLI-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)CCc1ccc(OC(C)C)cc1 |
|
~92%
propan-2-yl 3-(... CAS#:301224-94-2 |
| Literature: Jordis, Ulrich; Frohlich, Johannes; Treu, Matthias; Hirnschall, Manfred; Czollner, Laszlo; Kalz, Beate; Welzig, Stefan Patent: US2003/199493 A1, 2003 ; |
|
~%
propan-2-yl 3-(... CAS#:301224-94-2 |
| Literature: Garber, Steven B.; Kingsbury, Jason S.; Gray, Brian L.; Hoveyda, Amir H. Journal of the American Chemical Society, 2000 , vol. 122, # 34 p. 8168 - 8179 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |