7b-acetyl-5a,7a-dimethyl-4,5,5a,5b,6,7,7a,7b,8a,9,9a,9b,10,11-tetradecahydrooxireno[3',4']cyclopenta[1',2':5,6]naphtho[1,2-d]azepin-2(3h)-one structure
|
Common Name | 7b-acetyl-5a,7a-dimethyl-4,5,5a,5b,6,7,7a,7b,8a,9,9a,9b,10,11-tetradecahydrooxireno[3',4']cyclopenta[1',2':5,6]naphtho[1,2-d]azepin-2(3h)-one | ||
|---|---|---|---|---|
| CAS Number | 30122-75-9 | Molecular Weight | 343.46000 | |
| Density | 1.2g/cm3 | Boiling Point | 532.5ºC at 760 mmHg | |
| Molecular Formula | C21H29NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.8ºC | |
| Name | 7b-acetyl-5a,7a-dimethyl-4,5,5a,5b,6,7,7a,7b,8a,9,9a,9b,10,11-tetradecahydrooxireno[3',4']cyclopenta[1',2':5,6]naphtho[1,2-d]azepin-2(3h)-one |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 532.5ºC at 760 mmHg |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.46000 |
| Flash Point | 275.8ºC |
| Exact Mass | 343.21500 |
| PSA | 58.70000 |
| LogP | 3.34060 |
| Index of Refraction | 1.578 |
| InChIKey | HXSVEEDSVVYVLJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C12OC1CC1C3CCC4=CC(=O)NCCC4(C)C3CCC12C |
|
~%
7b-acetyl-5a,7a... CAS#:30122-75-9 |
| Literature: Singh,H.S.; Parashar,V.V. Indian Journal of Chemistry, 1970 , vol. 8, p. 875 - 876 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |