[(3-phenylmethoxyphenyl)methylideneamino]urea
Modify Date: 2025-08-28 15:06:04
![[(3-phenylmethoxyphenyl)methylideneamino]urea Structure](https://image.chemsrc.com/caspic/303/301202-73-3.png)
[(3-phenylmethoxyphenyl)methylideneamino]urea structure
|
Common Name | [(3-phenylmethoxyphenyl)methylideneamino]urea | ||
|---|---|---|---|---|
| CAS Number | 301202-73-3 | Molecular Weight | 269.29900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(3-phenylmethoxyphenyl)methylideneamino]urea |
|---|
| Molecular Formula | C15H15N3O2 |
|---|---|
| Molecular Weight | 269.29900 |
| Exact Mass | 269.11600 |
| PSA | 77.70000 |
| LogP | 3.17250 |
| InChIKey | UMKRRWOQQIBNIC-UHFFFAOYSA-N |
| SMILES | NC(=O)NN=Cc1cccc(OCc2ccccc2)c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |