α-Isobutyl-α-(2-morpholinoethyl)-1-naphthaleneacetaldehyde structure
|
Common Name | α-Isobutyl-α-(2-morpholinoethyl)-1-naphthaleneacetaldehyde | ||
|---|---|---|---|---|
| CAS Number | 30120-90-2 | Molecular Weight | 339.47100 | |
| Density | 1.065g/cm3 | Boiling Point | 501.7ºC at 760mmHg | |
| Molecular Formula | C22H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.2ºC | |
| Name | 4-methyl-2-(2-morpholin-4-ylethyl)-2-naphthalen-1-ylpentanal |
|---|
| Density | 1.065g/cm3 |
|---|---|
| Boiling Point | 501.7ºC at 760mmHg |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.47100 |
| Flash Point | 257.2ºC |
| Exact Mass | 339.22000 |
| PSA | 29.54000 |
| LogP | 3.98280 |
| Index of Refraction | 1.558 |
| InChIKey | IDIXYSWMUZWYNV-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C=O)(CCN1CCOCC1)c1cccc2ccccc12 |
| HS Code | 2934999090 |
|---|
|
~%
α-Isobutyl-α-(2... CAS#:30120-90-2 |
| Literature: Pala; Donetti; Mantegani; Crescenzi; Lumachi; Coppi Journal of medicinal chemistry, 1970 , vol. 13, # 6 p. 1089 - 1092 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |