Desvenlafaxine hydrochloride
Modify Date: 2025-08-23 19:21:12
Desvenlafaxine hydrochloride structure
|
Common Name | Desvenlafaxine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 300827-87-6 | Molecular Weight | 299.83600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H26ClNO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 4-[2-(Dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol hydrochl oride (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H26ClNO2 |
|---|---|
| Molecular Weight | 299.83600 |
| Exact Mass | 299.16500 |
| PSA | 43.70000 |
| LogP | 3.53460 |
| InChIKey | IMWPSXHIEURNKZ-UHFFFAOYSA-N |
| SMILES | CN(C)CC(c1ccc(O)cc1)C1(O)CCCCC1.Cl |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2922509090 |
|
~%
Desvenlafaxine ... CAS#:300827-87-6 |
| Literature: CHEMO IBERICA, S.A.; MOLINA PONCE, Andres; GRACIA GARCIA, Jesus Angel Patent: WO2010/79046 A1, 2010 ; Location in patent: Page/Page column 9-10 ; |
|
~%
Desvenlafaxine ... CAS#:300827-87-6 |
| Literature: KRKA Patent: EP2119695 A1, 2009 ; Location in patent: Page/Page column 6 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| O-desmethylvenlafaxine hydrochloride |
| DVS 233 |
| 1-[2-(dimethylamino)-1-(4-hydroxyphenyl)ethyl]cyclohexanol |
| desmethyl-venlafaxine |
| Desvenlafaxine |
| O-Desmethylvenlafaxine |
| (1RS)-4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol hydrochloride |
| Desvenlafaxine [INN:BAN] |
| Desvenlafaxine (INN) |
| Norvenlafaxine |
| 4-(2-(Dimethylamino)-1-(1-hydroxycyclohexyl)ethyl)phenol |
| desvenlafaxine hydrochloride |
| Desvenlafaxine Hydrochloride |