2,2-bis[[(1-oxooctyl)oxy]methyl]-1,3-propanediyl dioctanoate
Modify Date: 2025-09-20 08:13:48
![2,2-bis[[(1-oxooctyl)oxy]methyl]-1,3-propanediyl dioctanoate Structure](https://image.chemsrc.com/caspic/184/3008-50-2.png)
2,2-bis[[(1-oxooctyl)oxy]methyl]-1,3-propanediyl dioctanoate structure
|
Common Name | 2,2-bis[[(1-oxooctyl)oxy]methyl]-1,3-propanediyl dioctanoate | ||
|---|---|---|---|---|
| CAS Number | 3008-50-2 | Molecular Weight | 640.93100 | |
| Density | 0.981g/cm3 | Boiling Point | 659.5ºC at 760mmHg | |
| Molecular Formula | C37H68O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.2ºC | |
| Name | [3-octanoyloxy-2,2-bis(octanoyloxymethyl)propyl] octanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.981g/cm3 |
|---|---|
| Boiling Point | 659.5ºC at 760mmHg |
| Molecular Formula | C37H68O8 |
| Molecular Weight | 640.93100 |
| Flash Point | 262.2ºC |
| Exact Mass | 640.49100 |
| PSA | 105.20000 |
| LogP | 9.58760 |
| Index of Refraction | 1.464 |
| InChIKey | CFRNDJFRRKMHTL-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OCC(COC(=O)CCCCCCC)(COC(=O)CCCCCCC)COC(=O)CCCCCCC |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Tetra-O-octanoyl-pentaerythrit |
| EINECS 221-123-8 |
| Pentaerythritol tetracaprylate |
| pentaerythrityl tetracaprylate |
| Pentaerythritol tetraoctanoate |
| tetra-O-octanoyl-pentaerythritol |