3-Anilino-2-(3,4,5-trimethoxybenzyl)acrylonitrile
Modify Date: 2025-08-25 15:31:58
3-Anilino-2-(3,4,5-trimethoxybenzyl)acrylonitrile structure
|
Common Name | 3-Anilino-2-(3,4,5-trimethoxybenzyl)acrylonitrile | ||
|---|---|---|---|---|
| CAS Number | 30078-48-9 | Molecular Weight | 324.374 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 500.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H20N2O3 | Melting Point | 130-136ºC | |
| MSDS | N/A | Flash Point | 256.3±30.1 °C | |
| Name | 3-Anilino-2-(3,4,5-trimethoxybenzyl)acrylonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 500.2±50.0 °C at 760 mmHg |
| Melting Point | 130-136ºC |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.374 |
| Flash Point | 256.3±30.1 °C |
| Exact Mass | 324.147400 |
| PSA | 63.51000 |
| LogP | 3.05 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | LMGNGGBSQVPQCO-SQFISAMPSA-N |
| SMILES | COc1cc(CC(C#N)=CNc2ccccc2)cc(OC)c1OC |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2926909090 |
|
~%
3-Anilino-2-(3,... CAS#:30078-48-9 |
| Literature: Ji, Ya-Fei; Jiang, Jian-An; Liu, Hong-Wei; Liao, Dao-Hua; Wei, Xian-Yong Synthetic Communications, 2013 , vol. 43, # 11 p. 1517 - 1522 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:738-70-5| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-anilino-1-phenyl-pyrrolidine-2,5-dione |
| 3-Phenylamino-1-phenyl-2,5-pyrrolidindion |
| 3-Anilino-N-phenyl-pyrrolidin-2,5-dioxid |
| Benzenepropanenitrile, 3,4,5-trimethoxy-α-[(phenylamino)methylene]- |
| N-Phenyl-asparaginsaeure-phenylimid |
| 1-Phenyl-2,5-dioxo-3-anilino-pyrrolidin |
| 3-Anilino-1-phenyl-2,5-dioxo-pyrrolidin |
| 3-anilino-N-phenylsuccinimide |
| Trimethoprim Impurity I |