(4-nitrophenyl)methyl propanoate structure
|
Common Name | (4-nitrophenyl)methyl propanoate | ||
|---|---|---|---|---|
| CAS Number | 30039-44-2 | Molecular Weight | 209.19900 | |
| Density | 1.226g/cm3 | Boiling Point | 318.9ºC at 760mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.9ºC | |
| Name | (4-nitrophenyl)methyl propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 318.9ºC at 760mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 141.9ºC |
| Exact Mass | 209.06900 |
| PSA | 72.12000 |
| LogP | 2.57120 |
| Index of Refraction | 1.538 |
| InChIKey | KKWLVJAHJBMNLB-UHFFFAOYSA-N |
| SMILES | CCC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2915509000 |
|---|
|
~%
(4-nitrophenyl)... CAS#:30039-44-2 |
| Literature: Prashad, Mahavir; Jigajinni, Veerappa B. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 9 p. 822 - 823 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915509000 |
|---|---|
| Summary | 2915509000 propionic acid, its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| Benzenemethanol,4-nitro-,propanoate |
| 4-Nitrobenzenemethanol propanoate |
| p-Nitrobenzyl propionate |
| 4-Nitrobenzenemethanol propionate |