Propanedinitrile, 2-(9,10-dihydro-10-nitro-9-anthracenyl)- structure
|
Common Name | Propanedinitrile, 2-(9,10-dihydro-10-nitro-9-anthracenyl)- | ||
|---|---|---|---|---|
| CAS Number | 29925-31-3 | Molecular Weight | 289.28800 | |
| Density | 1.35g/cm3 | Boiling Point | 539.2ºC at 760mmHg | |
| Molecular Formula | C17H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.9ºC | |
| Name | 2-(10-nitro-9,10-dihydroanthracen-9-yl)propanedinitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 539.2ºC at 760mmHg |
| Molecular Formula | C17H11N3O2 |
| Molecular Weight | 289.28800 |
| Flash Point | 279.9ºC |
| Exact Mass | 289.08500 |
| PSA | 93.40000 |
| LogP | 3.68456 |
| Vapour Pressure | 1.07E-11mmHg at 25°C |
| Index of Refraction | 1.654 |
| InChIKey | SOVJCOFJKPASSR-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)C1c2ccccc2C([N+](=O)[O-])c2ccccc21 |
|
~%
Propanedinitril... CAS#:29925-31-3 |
| Literature: Williams,R.H.; Snyder,H.R. Journal of Organic Chemistry, 1971 , vol. 36, # 16 p. 2327 - 2332 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (10-nitro-9,10-dihydroanthracen-9-yl)propanedinitrile |