1-azido-1,1,2,3,3,3-hexafluoropropane
Modify Date: 2024-02-01 14:45:13
1-azido-1,1,2,3,3,3-hexafluoropropane structure
|
Common Name | 1-azido-1,1,2,3,3,3-hexafluoropropane | ||
|---|---|---|---|---|
| CAS Number | 2991-70-0 | Molecular Weight | 193.05100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3HF6N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-azido-1,1,2,3,3,3-hexafluoropropane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C3HF6N3 |
|---|---|
| Molecular Weight | 193.05100 |
| Exact Mass | 193.00700 |
| PSA | 49.75000 |
| LogP | 2.24266 |
| InChIKey | OGYFBIDRQWPKBM-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NC(F)(F)C(F)C(F)(F)F |
|
~%
1-azido-1,1,2,3... CAS#:2991-70-0 |
| Literature: Banks,R.E. et al. Journal of the Chemical Society [Section] C: Organic, 1970 , p. 1017 - 1023 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:5954-50-7| 2H-Perfluoropropyl azide |
| 2H-Hexafluorpropylazid |
| 2-hydroperfluoropropyl azide |
| 2-H-Hexafluoropropylazid |
| 1-azido-1,1,2,3,3,3-hexafluoro-propane |
| 1,1,2,3,3,3-Hexafluor-1-azido-propan |
| Propane,1-azido-1,1,2,3,3,3-hexafluoro |