Benzeneacetamide,N-[2-(dimethylamino)ethyl]-a-hydroxy-N,a-diphenyl- structure
|
Common Name | Benzeneacetamide,N-[2-(dimethylamino)ethyl]-a-hydroxy-N,a-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 29850-00-8 | Molecular Weight | 374.47500 | |
| Density | 1.17g/cm3 | Boiling Point | 540.3ºC at 760mmHg | |
| Molecular Formula | C24H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.5ºC | |
| Name | N-[2-(dimethylamino)ethyl]-2-hydroxy-N,2,2-triphenylacetamide |
|---|
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 540.3ºC at 760mmHg |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.47500 |
| Flash Point | 280.5ºC |
| Exact Mass | 374.19900 |
| PSA | 43.78000 |
| LogP | 3.51730 |
| Vapour Pressure | 1.67E-12mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | ZPEKTHPXHMEFJA-UHFFFAOYSA-N |
| SMILES | CN(C)CCN(C(=O)C(O)(c1ccccc1)c1ccccc1)c1ccccc1 |
|
~%
Benzeneacetamid... CAS#:29850-00-8 |
| Literature: Krapcho et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 3632 |
|
~%
Benzeneacetamid... CAS#:29850-00-8 |
| Literature: Shklyaev,V.S.; Pantsurkin,V.I. Zhurnal Organicheskoi Khimii, 1968 , vol. 4, p. 288 - 293,279 - 284 |
|
~%
Benzeneacetamid... CAS#:29850-00-8 |
| Literature: Shklyaev,V.S.; Pantsurkin,V.I. Zhurnal Organicheskoi Khimii, 1968 , vol. 4, p. 288 - 293,279 - 284 |
|
~%
Benzeneacetamid... CAS#:29850-00-8 |
| Literature: Shklyaev,V.S.; Pantsurkin,V.I. Zhurnal Organicheskoi Khimii, 1968 , vol. 4, p. 288 - 293,279 - 284 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |