(4-nitrophenyl) 3-oxobutanoate structure
|
Common Name | (4-nitrophenyl) 3-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 29816-97-5 | Molecular Weight | 223.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-nitrophenyl) 3-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9NO5 |
|---|---|
| Molecular Weight | 223.18200 |
| Exact Mass | 223.04800 |
| PSA | 89.19000 |
| LogP | 2.00250 |
| InChIKey | DVMIJADCZHWVHO-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)Oc1ccc([N+](=O)[O-])cc1 |
|
~%
(4-nitrophenyl)... CAS#:29816-97-5 |
| Literature: Pratt,R.F.; Bruice,T.C. Journal of the American Chemical Society, 1970 , vol. 92, p. 5956 - 5964 |
|
~51%
(4-nitrophenyl)... CAS#:29816-97-5 |
| Literature: Clemens, Robert J.; Hyatt, John A. Journal of Organic Chemistry, 1985 , vol. 50, # 14 p. 2431 - 2435 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| p-Nitrophenyl-acetoacetat |
| Butanoic acid,3-oxo-,4-nitrophenyl ester |