Ethanedioic acid,1,2-bis[2-(1-phenylethylidene)hydrazide] structure
|
Common Name | Ethanedioic acid,1,2-bis[2-(1-phenylethylidene)hydrazide] | ||
|---|---|---|---|---|
| CAS Number | 29816-35-1 | Molecular Weight | 322.36100 | |
| Density | 1.16g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N'-bis[(E)-1-phenylethylideneamino]oxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.36100 |
| Exact Mass | 322.14300 |
| PSA | 82.92000 |
| LogP | 2.84900 |
| Index of Refraction | 1.593 |
| InChIKey | WZTXYSAPKCVHNM-IWGRKNQJSA-N |
| SMILES | CC(=NNC(=O)C(=O)NN=C(C)c1ccccc1)c1ccccc1 |
|
~%
Ethanedioic aci... CAS#:29816-35-1 |
| Literature: Wilson; Pickering Journal of the Chemical Society, 1925 , vol. 127, p. 967 |
|
~%
Ethanedioic aci... CAS#:29816-35-1 |
| Literature: Wilson; Pickering Journal of the Chemical Society, 1925 , vol. 127, p. 967 |
|
~%
Ethanedioic aci... CAS#:29816-35-1 |
| Literature: Wilson; Pickering Journal of the Chemical Society, 1925 , vol. 127, p. 967 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| acetophenone-oxaloyldihydrazone |