2-methyl-4-morpholin-4-yl-2-phenylbutanamide
Modify Date: 2024-01-29 08:34:21
2-methyl-4-morpholin-4-yl-2-phenylbutanamide structure
|
Common Name | 2-methyl-4-morpholin-4-yl-2-phenylbutanamide | ||
|---|---|---|---|---|
| CAS Number | 2977-25-5 | Molecular Weight | 262.34700 | |
| Density | 1.102g/cm3 | Boiling Point | 465ºC at 760mmHg | |
| Molecular Formula | C15H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235ºC | |
| Name | 2-methyl-4-morpholin-4-yl-2-phenylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.102g/cm3 |
|---|---|
| Boiling Point | 465ºC at 760mmHg |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.34700 |
| Flash Point | 235ºC |
| Exact Mass | 262.16800 |
| PSA | 56.55000 |
| LogP | 2.23950 |
| Vapour Pressure | 7.99E-09mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | OCHUSCDFUYOEMO-UHFFFAOYSA-N |
| SMILES | CC(CCN1CCOCC1)(C(N)=O)c1ccccc1 |
|
~%
2-methyl-4-morp... CAS#:2977-25-5 |
| Literature: Casadio,S. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 594 - 598 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| BUTYRAMIDE,2-METHYL-4-MORPHOLINO-2-PHENYL |
| 2-methyl-4-morpholin-4-yl-2-phenyl-butyramide |