N-methyl-N-(2-nitrophenoxy)methanamine
Modify Date: 2025-10-18 17:55:59
N-methyl-N-(2-nitrophenoxy)methanamine structure
|
Common Name | N-methyl-N-(2-nitrophenoxy)methanamine | ||
|---|---|---|---|---|
| CAS Number | 29746-93-8 | Molecular Weight | 182.17700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-methyl-N-(2-nitrophenoxy)methanamine |
|---|
| Molecular Formula | C8H10N2O3 |
|---|---|
| Molecular Weight | 182.17700 |
| Exact Mass | 182.06900 |
| PSA | 58.29000 |
| LogP | 1.97340 |
| InChIKey | NCQDEWKTXXIZHB-UHFFFAOYSA-N |
| SMILES | CN(C)Oc1ccccc1[N+](=O)[O-] |
|
~%
N-methyl-N-(2-n... CAS#:29746-93-8 |
| Literature: Khuthier,A.H. et al. Journal of the Chemical Society, Chemical Communications, 1976 , # 24 p. 1001 - 1002 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |