2-amino-6-butan-2-yl-4-nitro-phenol structure
|
Common Name | 2-amino-6-butan-2-yl-4-nitro-phenol | ||
|---|---|---|---|---|
| CAS Number | 29709-87-3 | Molecular Weight | 210.23000 | |
| Density | 1.247g/cm3 | Boiling Point | 360.3ºC at 760mmHg | |
| Molecular Formula | C10H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.7ºC | |
| Name | 2-amino-6-butan-2-yl-4-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 360.3ºC at 760mmHg |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23000 |
| Flash Point | 171.7ºC |
| Exact Mass | 210.10000 |
| PSA | 92.07000 |
| LogP | 3.50050 |
| Vapour Pressure | 1.08E-05mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | CIMKCSKJNMVQAL-UHFFFAOYSA-N |
| SMILES | CCC(C)c1cc([N+](=O)[O-])cc(N)c1O |
| HS Code | 2922299090 |
|---|
|
~%
2-amino-6-butan... CAS#:29709-87-3 |
| Literature: Ernst,W.; Baer,F. Arzneimittel Forschung, 1964 , vol. 14, # 2 p. 81 - 84 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-AMINO-6-BUTAN-2-YL-4-NITRO-PHENOL |
| 6-Amino-2-sec-butyl-4-nitrophenol |
| 2-Amino-4-nitro-6-sek-butylphenol |