5-sec-Butyl-5-ethyl-1-methyl-2-thioxo-2,3-dihydropyrimidine-4,6(1H,5H)-dione structure
|
Common Name | 5-sec-Butyl-5-ethyl-1-methyl-2-thioxo-2,3-dihydropyrimidine-4,6(1H,5H)-dione | ||
|---|---|---|---|---|
| CAS Number | 29639-65-4 | Molecular Weight | 242.33800 | |
| Density | 1.17g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H18N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-butan-2-yl-5-ethyl-1-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.33800 |
| Exact Mass | 242.10900 |
| PSA | 84.99000 |
| LogP | 1.51580 |
| Index of Refraction | 1.55 |
| InChIKey | CNGMYBINWGHKIM-UHFFFAOYSA-N |
| SMILES | CCC(C)C1(CC)C(=O)NC(=S)N(C)C1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-sec-Butyl-5-ethyl-1-methyl-2-thio-barbituric acid |
| N-Methyl-thiobutabarbital |
| BARBITURIC ACID,5-sec-BUTYL-5-ETHYL-1-METHYL-2-THIO |