Pyrene,1-nitro-6-nitroso structure
|
Common Name | Pyrene,1-nitro-6-nitroso | ||
|---|---|---|---|---|
| CAS Number | 2961-09-3 | Molecular Weight | 299.32300 | |
| Density | 1.334g/cm3 | Boiling Point | 411.7ºC at 760 mmHg | |
| Molecular Formula | C20H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.1ºC | |
| Name | Pyrene,1-nitro-6-nitroso |
|---|---|
| Synonym | More Synonyms |
| Density | 1.334g/cm3 |
|---|---|
| Boiling Point | 411.7ºC at 760 mmHg |
| Molecular Formula | C20H13NO2 |
| Molecular Weight | 299.32300 |
| Flash Point | 184.1ºC |
| Exact Mass | 299.09500 |
| PSA | 45.82000 |
| LogP | 5.10520 |
| Vapour Pressure | 1.3E-06mmHg at 25°C |
| Index of Refraction | 1.709 |
| InChIKey | DHXMOTPZFJLSFZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc2c1C1c3ccccc3C2c2ccccc21 |
|
~%
Pyrene,1-nitro-... CAS#:2961-09-3 |
| Literature: Paget,C.J.; Burger,A. Journal of Organic Chemistry, 1965 , vol. 30, p. 1329 - 1331 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-Nitroso-6-nitropyrene |
| 1-Nitro-triptycen |