4-[(4-chlorophenyl)hydrazinylidene]-3-hydroxycyclohexa-2,5-dien-1-one structure
|
Common Name | 4-[(4-chlorophenyl)hydrazinylidene]-3-hydroxycyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 29600-20-2 | Molecular Weight | 248.66500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(4-chlorophenyl)hydrazinylidene]-3-hydroxycyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9ClN2O2 |
|---|---|
| Molecular Weight | 248.66500 |
| Exact Mass | 248.03500 |
| PSA | 61.69000 |
| LogP | 2.76170 |
| InChIKey | XIQBUZRHORLUFE-UHFFFAOYSA-N |
| SMILES | Oc1ccc(N=Nc2ccc(Cl)cc2)c(O)c1 |
|
~%
4-[(4-chlorophe... CAS#:29600-20-2 |
| Literature: Briffett, Neil E.; Hibbert, Frank; Sellens, Rowena J. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1988 , p. 2123 - 2128 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2,4-Dihydroxy-4'-chlor-azobenzol |
| 2,4-dihydroxy-4'-chloroazobenzene |
| 4-Chlor-2',4'-dihydroxyazobenzol |