5-Pyrimidineaceticacid, 3,4-dihydro-2-(methylthio)-4-oxo-, ethyl ester structure
|
Common Name | 5-Pyrimidineaceticacid, 3,4-dihydro-2-(methylthio)-4-oxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 29571-44-6 | Molecular Weight | 228.26800 | |
| Density | 1.32g/cm3 | Boiling Point | 379.5ºC at 760 mmHg | |
| Molecular Formula | C9H12N2O3S | Melting Point | 188-189 °C | |
| MSDS | N/A | Flash Point | 183.3ºC | |
| Name | ethyl 2-(2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 379.5ºC at 760 mmHg |
| Melting Point | 188-189 °C |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.26800 |
| Flash Point | 183.3ºC |
| Exact Mass | 228.05700 |
| PSA | 97.35000 |
| LogP | 0.59740 |
| Vapour Pressure | 2.67E-06mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | GKBOFJXGVIZNBD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1cnc(SC)[nH]c1=O |
| Storage condition | 2-8°C |
| HS Code | 2933599090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 2-(2-(methylthio)-6-oxo-1,6-dihydropyrimidin-5-yl)acetate |
| ETHYL 2-(4-HYDROXY-2-(METHYLTHIO)PYRIMIDIN-5-YL)ACETATE |
| 4-Hydroxy-2-(methylthio)-5-pyrimidineacetic acid ethyl ester |
| 5-Pyrimidineaceticacid,3,4-dihydro-2-(methylthio)-4-oxo-,ethyl ester |
| (2-methylsulfanyl-6-oxo-1,6-dihydro-pyrimidin-5-yl)-acetic acid ethyl ester |