1,2,4,5-Tetrafluoro-3-methoxy-6-vinylbenzene
Modify Date: 2025-08-27 09:38:21
1,2,4,5-Tetrafluoro-3-methoxy-6-vinylbenzene structure
|
Common Name | 1,2,4,5-Tetrafluoro-3-methoxy-6-vinylbenzene | ||
|---|---|---|---|---|
| CAS Number | 29551-55-1 | Molecular Weight | 206.13700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6F4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,4,5-Tetrafluoro-3-methoxy-6-vinylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H6F4O |
|---|---|
| Molecular Weight | 206.13700 |
| Exact Mass | 206.03500 |
| PSA | 9.23000 |
| LogP | 2.89460 |
| InChIKey | TXDDBHZHCZRAJT-UHFFFAOYSA-N |
| SMILES | C=Cc1c(F)c(F)c(OC)c(F)c1F |
| HS Code | 2909309090 |
|---|
|
~%
1,2,4,5-Tetrafl... CAS#:29551-55-1 |
| Literature: Burdon,J.; Westwood,W.T. Journal of the Chemical Society [Section] C: Organic, 1970 , p. 1271 - 1272 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,3,5,6-Tetrafluoro-4-methoxystyrol |
| 2,3,5,6-tetrafluoro-4-methoxybenzyl alcohol |
| 4-METHOXY-2,3,5,6-TETRAFLUOROBENZYL ALCOHOL |
| 1,2,4,5-tetrafluoro-3-methoxy-6-vinyl-benzene |
| 2,3,5,6-Tetrafluoro-4-methoxybenzyl-alkohol |