Eupalitin
Modify Date: 2025-08-24 22:39:15
Eupalitin structure
|
Common Name | Eupalitin | ||
|---|---|---|---|---|
| CAS Number | 29536-41-2 | Molecular Weight | 330.28900 | |
| Density | 1.507g/cm3 | Boiling Point | 587.7ºC at 760mmHg | |
| Molecular Formula | C17H14O7 | Melting Point | 289-292℃ | |
| MSDS | Chinese USA | Flash Point | 219.7ºC | |
| Name | 3,5-dihydroxy-2-(4-hydroxyphenyl)-6,7-dimethoxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.507g/cm3 |
|---|---|
| Boiling Point | 587.7ºC at 760mmHg |
| Melting Point | 289-292℃ |
| Molecular Formula | C17H14O7 |
| Molecular Weight | 330.28900 |
| Flash Point | 219.7ºC |
| Exact Mass | 330.07400 |
| PSA | 109.36000 |
| LogP | 2.59400 |
| Vapour Pressure | 1.18E-14mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | KWMAWXWUGIEVDG-UHFFFAOYSA-N |
| SMILES | COc1cc2oc(-c3ccc(O)cc3)c(O)c(=O)c2c(O)c1OC |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2914509090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:4472-73-5| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Eupalitin induces apoptosis in prostate carcinoma cells through ROS generation and increase of caspase-3 activity.
Cell Biol. Int. 40 , 196-203, (2016) Prostate cancer is the second most common malignancy in the human reproductive system. Eupalitin is one of the O-methylated flavonol-exhibited enhanced cancer chemopreventive agents. The current study... |
| 4H-1-Benzopyran-4-one,3,5-dihydroxy-2-(4-hydroxyphenyl)-6,7-dimethoxy |
| Eupalitin |
| 6,7-Dimethoxy-3,5,4'-trihydroxyflavone |